Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Benzylamine, 99%, pure
CAS: 100-46-9 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.15 MDL Number: MFCD00008106 InChI Key: WGQKYBSKWIADBV-UHFFFAOYSA-N Synonym: benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine PubChem CID: 7504 ChEBI: CHEBI:40538 IUPAC Name: phenylmethanamine SMILES: C1=CC=C(C=C1)CN
| PubChem CID | 7504 |
|---|---|
| CAS | 100-46-9 |
| Molecular Weight (g/mol) | 107.15 |
| ChEBI | CHEBI:40538 |
| MDL Number | MFCD00008106 |
| SMILES | C1=CC=C(C=C1)CN |
| Synonym | benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine |
| IUPAC Name | phenylmethanamine |
| InChI Key | WGQKYBSKWIADBV-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |
1-Boc-piperazine, 99%
CAS: 57260-71-6 Molecular Formula: C9H19N2O2 Molecular Weight (g/mol): 187.26 MDL Number: MFCD00075265 InChI Key: CWXPZXBSDSIRCS-UHFFFAOYSA-O Synonym: 1-boc-piperazine,n-boc-piperazine,1-n-boc-piperazine,tert-butyl 1-piperazinecarboxylate,1-tert-butoxycarbonyl piperazine,n-t-butoxycarbonylpiperazine,boc-piperazine,n-tert-butoxycarbonylpiperazine,piperazine-1-carboxylic acid tert-butyl ester,1-piperazinecarboxylic acid, 1,1-dimethylethyl ester PubChem CID: 143452 IUPAC Name: tert-butyl piperazine-1-carboxylate SMILES: CC(C)(C)OC(=O)N1CC[NH2+]CC1
| PubChem CID | 143452 |
|---|---|
| CAS | 57260-71-6 |
| Molecular Weight (g/mol) | 187.26 |
| MDL Number | MFCD00075265 |
| SMILES | CC(C)(C)OC(=O)N1CC[NH2+]CC1 |
| Synonym | 1-boc-piperazine,n-boc-piperazine,1-n-boc-piperazine,tert-butyl 1-piperazinecarboxylate,1-tert-butoxycarbonyl piperazine,n-t-butoxycarbonylpiperazine,boc-piperazine,n-tert-butoxycarbonylpiperazine,piperazine-1-carboxylic acid tert-butyl ester,1-piperazinecarboxylic acid, 1,1-dimethylethyl ester |
| IUPAC Name | tert-butyl piperazine-1-carboxylate |
| InChI Key | CWXPZXBSDSIRCS-UHFFFAOYSA-O |
| Molecular Formula | C9H19N2O2 |
4-Chlorobenzyl alcohol, 99%
CAS: 873-76-7 Molecular Formula: C7H7ClO Molecular Weight (g/mol): 142.58 MDL Number: MFCD00004652 InChI Key: PTHGDVCPCZKZKR-UHFFFAOYSA-N Synonym: 4-chlorobenzyl alcohol,4-chlorophenyl methanol,p-chlorobenzyl alcohol,benzenemethanol, 4-chloro,4-chlorobenzenemethanol,4-chlorobenzylalcohol,benzyl alcohol, p-chloro,4-chlorobenzylic alcohol,unii-gf8bs53b6v,ccris 5120 PubChem CID: 13397 IUPAC Name: (4-chlorophenyl)methanol SMILES: C1=CC(=CC=C1CO)Cl
| PubChem CID | 13397 |
|---|---|
| CAS | 873-76-7 |
| Molecular Weight (g/mol) | 142.58 |
| MDL Number | MFCD00004652 |
| SMILES | C1=CC(=CC=C1CO)Cl |
| Synonym | 4-chlorobenzyl alcohol,4-chlorophenyl methanol,p-chlorobenzyl alcohol,benzenemethanol, 4-chloro,4-chlorobenzenemethanol,4-chlorobenzylalcohol,benzyl alcohol, p-chloro,4-chlorobenzylic alcohol,unii-gf8bs53b6v,ccris 5120 |
| IUPAC Name | (4-chlorophenyl)methanol |
| InChI Key | PTHGDVCPCZKZKR-UHFFFAOYSA-N |
| Molecular Formula | C7H7ClO |
m-Cresol, 99%
CAS: 108-39-4 Molecular Formula: C7H8O Molecular Weight (g/mol): 108.14 MDL Number: MFCD00002302 InChI Key: RLSSMJSEOOYNOY-UHFFFAOYSA-N Synonym: m-cresol,metacresol,meta-cresol,phenol, 3-methyl,3-hydroxytoluene,m-methylphenol,3-cresol,m-kresol,m-oxytoluene,m-toluol PubChem CID: 342 ChEBI: CHEBI:17231 IUPAC Name: 3-methylphenol SMILES: CC1=CC(=CC=C1)O
| PubChem CID | 342 |
|---|---|
| CAS | 108-39-4 |
| Molecular Weight (g/mol) | 108.14 |
| ChEBI | CHEBI:17231 |
| MDL Number | MFCD00002302 |
| SMILES | CC1=CC(=CC=C1)O |
| Synonym | m-cresol,metacresol,meta-cresol,phenol, 3-methyl,3-hydroxytoluene,m-methylphenol,3-cresol,m-kresol,m-oxytoluene,m-toluol |
| IUPAC Name | 3-methylphenol |
| InChI Key | RLSSMJSEOOYNOY-UHFFFAOYSA-N |
| Molecular Formula | C7H8O |
Azulene, 99%
CAS: 275-51-4 Molecular Formula: C10H8 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00003810 InChI Key: CUFNKYGDVFVPHO-UHFFFAOYSA-N Synonym: cyclopentacycloheptene,azunamic,bicyclo 5.3.0 decapentaene,azulen,unii-82r6m9mglp,bicyclo 5.3.0-1,3,5,7,9-decapentaene,bicyclo 5.3.0-deca-2,4,6,8,10-pentaene,82r6m9mglp,azulekeep PubChem CID: 9231 ChEBI: CHEBI:31249 IUPAC Name: azulene SMILES: C1=CC=C2C=CC=C2C=C1
| PubChem CID | 9231 |
|---|---|
| CAS | 275-51-4 |
| Molecular Weight (g/mol) | 128.17 |
| ChEBI | CHEBI:31249 |
| MDL Number | MFCD00003810 |
| SMILES | C1=CC=C2C=CC=C2C=C1 |
| Synonym | cyclopentacycloheptene,azunamic,bicyclo 5.3.0 decapentaene,azulen,unii-82r6m9mglp,bicyclo 5.3.0-1,3,5,7,9-decapentaene,bicyclo 5.3.0-deca-2,4,6,8,10-pentaene,82r6m9mglp,azulekeep |
| IUPAC Name | azulene |
| InChI Key | CUFNKYGDVFVPHO-UHFFFAOYSA-N |
| Molecular Formula | C10H8 |
2-Chlorobenzothiazole, 99%
CAS: 615-20-3 Molecular Formula: C7H4ClNS Molecular Weight (g/mol): 169.63 InChI Key: BSQLQMLFTHJVKS-UHFFFAOYSA-N Synonym: 2-chlorobenzothiazole,benzothiazole, 2-chloro,2-chlorobenzo d thiazole,2-benzothiazolyl chloride,usaf ek-2784,2-chloro-benzothiazole,benzothiazole, chloro,unii-fn1t1y0p5p,fn1t1y0p5p,2-chlorobenzthiazole PubChem CID: 11987 IUPAC Name: 2-chloro-1,3-benzothiazole SMILES: C1=CC=C2C(=C1)N=C(S2)Cl
| PubChem CID | 11987 |
|---|---|
| CAS | 615-20-3 |
| Molecular Weight (g/mol) | 169.63 |
| SMILES | C1=CC=C2C(=C1)N=C(S2)Cl |
| Synonym | 2-chlorobenzothiazole,benzothiazole, 2-chloro,2-chlorobenzo d thiazole,2-benzothiazolyl chloride,usaf ek-2784,2-chloro-benzothiazole,benzothiazole, chloro,unii-fn1t1y0p5p,fn1t1y0p5p,2-chlorobenzthiazole |
| IUPAC Name | 2-chloro-1,3-benzothiazole |
| InChI Key | BSQLQMLFTHJVKS-UHFFFAOYSA-N |
| Molecular Formula | C7H4ClNS |
Dextran, MW ca 20,000
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N Synonym: dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal PubChem CID: 4125253 IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| PubChem CID | 4125253 |
|---|---|
| CAS | 9004-54-0 |
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| Synonym | dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
Tri-n-butyl phosphite, 94%
CAS: 102-85-2 Molecular Formula: C12H27O3P Molecular Weight (g/mol): 250.319 MDL Number: MFCD00009437 InChI Key: XTTGYFREQJCEML-UHFFFAOYSA-N Synonym: tri-n-butyl phosphite,phosphorous acid, tributyl ester,tributoxyphosphine,tributylfosfit,butyl phosphite c4h9o 3p,tributylfosfit czech,tributylphosphite,phosphorus tributoxide p obu 3,tri-n-butylphosphite,1-butanol, 1,1',1-phosphinidynetri PubChem CID: 7623 IUPAC Name: tributyl phosphite SMILES: CCCCOP(OCCCC)OCCCC
| PubChem CID | 7623 |
|---|---|
| CAS | 102-85-2 |
| Molecular Weight (g/mol) | 250.319 |
| MDL Number | MFCD00009437 |
| SMILES | CCCCOP(OCCCC)OCCCC |
| Synonym | tri-n-butyl phosphite,phosphorous acid, tributyl ester,tributoxyphosphine,tributylfosfit,butyl phosphite c4h9o 3p,tributylfosfit czech,tributylphosphite,phosphorus tributoxide p obu 3,tri-n-butylphosphite,1-butanol, 1,1',1-phosphinidynetri |
| IUPAC Name | tributyl phosphite |
| InChI Key | XTTGYFREQJCEML-UHFFFAOYSA-N |
| Molecular Formula | C12H27O3P |
2-Pyrrolidinone, 99%
CAS: 616-45-5 Molecular Formula: C4H7NO Molecular Weight (g/mol): 85.11 MDL Number: MFCD00005270 InChI Key: HNJBEVLQSNELDL-UHFFFAOYSA-N Synonym: 2-pyrrolidinone,pyrrolidone,butyrolactam,2-pyrrolidone,2-oxopyrrolidine,pyrrolidon,2-ketopyrrolidine,2-pyrol,pyrrolidinone,gamma-butyrolactam PubChem CID: 12025 ChEBI: CHEBI:36592 IUPAC Name: pyrrolidin-2-one SMILES: C1CC(=O)NC1
| PubChem CID | 12025 |
|---|---|
| CAS | 616-45-5 |
| Molecular Weight (g/mol) | 85.11 |
| ChEBI | CHEBI:36592 |
| MDL Number | MFCD00005270 |
| SMILES | C1CC(=O)NC1 |
| Synonym | 2-pyrrolidinone,pyrrolidone,butyrolactam,2-pyrrolidone,2-oxopyrrolidine,pyrrolidon,2-ketopyrrolidine,2-pyrol,pyrrolidinone,gamma-butyrolactam |
| IUPAC Name | pyrrolidin-2-one |
| InChI Key | HNJBEVLQSNELDL-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO |
Sodium n-decyl sulfate, 98%
CAS: 142-87-0 Molecular Formula: C10H21NaO4S Molecular Weight (g/mol): 260.324 MDL Number: MFCD00041881 InChI Key: XZTJQQLJJCXOLP-UHFFFAOYSA-M Synonym: sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt PubChem CID: 23665771 IUPAC Name: sodium;decyl sulfate SMILES: CCCCCCCCCCOS(=O)(=O)[O-].[Na+]
| PubChem CID | 23665771 |
|---|---|
| CAS | 142-87-0 |
| Molecular Weight (g/mol) | 260.324 |
| MDL Number | MFCD00041881 |
| SMILES | CCCCCCCCCCOS(=O)(=O)[O-].[Na+] |
| Synonym | sodium decyl sulfate,sodium n-decyl sulfate,decyl sodium sulfate,sulfuric acid, monodecyl ester, sodium salt,sodium decyl sulphate,unii-al92m833sy,n-decyl sodium sulfate,sodium n-decylsulphate,sulfuric acid, monodecyl ester, sodium salt 1:1,sulfuric acid, decyl ester, sodium salt |
| IUPAC Name | sodium;decyl sulfate |
| InChI Key | XZTJQQLJJCXOLP-UHFFFAOYSA-M |
| Molecular Formula | C10H21NaO4S |
4'-Ethoxyacetanilide, 97%, Thermo Scientific Chemicals
CAS: 62-44-2 Molecular Formula: C10H13NO2 Molecular Weight (g/mol): 179.219 MDL Number: MFCD00009094 InChI Key: CPJSUEIXXCENMM-UHFFFAOYSA-N Synonym: phenacetin,acetophenetidin,n-4-ethoxyphenyl acetamide,acetphenetidin,acetophenetidine,acetophenetin,phenacetine,p-acetophenetidide,contradouleur,achrocidin PubChem CID: 4754 ChEBI: CHEBI:8050 IUPAC Name: N-(4-ethoxyphenyl)acetamide SMILES: CCOC1=CC=C(C=C1)NC(=O)C
| PubChem CID | 4754 |
|---|---|
| CAS | 62-44-2 |
| Molecular Weight (g/mol) | 179.219 |
| ChEBI | CHEBI:8050 |
| MDL Number | MFCD00009094 |
| SMILES | CCOC1=CC=C(C=C1)NC(=O)C |
| Synonym | phenacetin,acetophenetidin,n-4-ethoxyphenyl acetamide,acetphenetidin,acetophenetidine,acetophenetin,phenacetine,p-acetophenetidide,contradouleur,achrocidin |
| IUPAC Name | N-(4-ethoxyphenyl)acetamide |
| InChI Key | CPJSUEIXXCENMM-UHFFFAOYSA-N |
| Molecular Formula | C10H13NO2 |
Bis(2-methoxyethyl) ether, 99+%, Extra Dry, AcroSeal™
CAS: 111-96-6 Molecular Formula: C6H14O3 Molecular Weight (g/mol): 134.18 MDL Number: MFCD00008503 InChI Key: SBZXBUIDTXKZTM-UHFFFAOYSA-N Synonym: diglyme,bis 2-methoxyethyl ether,2-methoxyethyl ether,1-methoxy-2-2-methoxyethoxy ethane,diethylene glycol dimethyl ether,poly-solv,di 2-methoxyethyl ether,dimethyl carbitol,2,5,8-trioxanonane PubChem CID: 8150 ChEBI: CHEBI:46784 IUPAC Name: 1-methoxy-2-(2-methoxyethoxy)ethane SMILES: COCCOCCOC
| PubChem CID | 8150 |
|---|---|
| CAS | 111-96-6 |
| Molecular Weight (g/mol) | 134.18 |
| ChEBI | CHEBI:46784 |
| MDL Number | MFCD00008503 |
| SMILES | COCCOCCOC |
| Synonym | diglyme,bis 2-methoxyethyl ether,2-methoxyethyl ether,1-methoxy-2-2-methoxyethoxy ethane,diethylene glycol dimethyl ether,poly-solv,di 2-methoxyethyl ether,dimethyl carbitol,2,5,8-trioxanonane |
| IUPAC Name | 1-methoxy-2-(2-methoxyethoxy)ethane |
| InChI Key | SBZXBUIDTXKZTM-UHFFFAOYSA-N |
| Molecular Formula | C6H14O3 |
Poly(ethylene oxide), M.W. 100,000 to 200,000
CAS: 25322-68-3 Molecular Formula: (C2H4O)n Molecular Weight (g/mol): 62.07 MDL Number: MFCD01779601 InChI Key: LYCAIKOWRPUZTN-UHFFFAOYSA-N Synonym: PEO IUPAC Name: ethane-1,2-diol SMILES: [H]OCCO
| CAS | 25322-68-3 |
|---|---|
| Molecular Weight (g/mol) | 62.07 |
| MDL Number | MFCD01779601 |
| SMILES | [H]OCCO |
| Synonym | PEO |
| IUPAC Name | ethane-1,2-diol |
| InChI Key | LYCAIKOWRPUZTN-UHFFFAOYSA-N |
| Molecular Formula | (C2H4O)n |
Cellulose powder, microcrystallline, >97%, MP Biomedicals™
CAS: 9004-34-6 Molecular Formula: (C6H10O5)n
| CAS | 9004-34-6 |
|---|---|
| Molecular Formula | (C6H10O5)n |
Triethylamine trihydrofluoride, ca 37% HF, Thermo Scientific Chemicals
CAS: 73602-61-6 Molecular Formula: C6H18F3N Molecular Weight (g/mol): 161.212 MDL Number: MFCD00043294 InChI Key: IKGLACJFEHSFNN-UHFFFAOYSA-N Synonym: triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 PubChem CID: 175505 IUPAC Name: N,N-diethylethanamine;trihydrofluoride SMILES: CCN(CC)CC.F.F.F
| PubChem CID | 175505 |
|---|---|
| CAS | 73602-61-6 |
| Molecular Weight (g/mol) | 161.212 |
| MDL Number | MFCD00043294 |
| SMILES | CCN(CC)CC.F.F.F |
| Synonym | triethylamine trihydrofluoride,n,n-diethylethanamine trihydrofluoride,triethylammonium fluoride,ethanamine, n,n-diethyl-, trihydrofluoride,triethylamine trishydrofluoride,hydrogen fluoride in triethylamine,hf in triethylamine,triethylaminetrihydrofluoride,hydrogen fluoride triethylamine,ethanamine, n,n-diethyl-, hydrofluoride 1:3 |
| IUPAC Name | N,N-diethylethanamine;trihydrofluoride |
| InChI Key | IKGLACJFEHSFNN-UHFFFAOYSA-N |
| Molecular Formula | C6H18F3N |